C15H15ClN2O4S — CID 1001980
N-[(2-chloro-4,5-dimethoxyphenyl)methylideneamino]benzenesulfonamide (PubChem CID 1001980) has the molecular formula C15H15ClN2O4S and a molecular weight of 354.82 g/mol. Its IUPAC name is N-[(2-chloro-4,5-dimethoxyphenyl)methylideneamino]benzenesulfonamide.
| Compound Name | N-[(2-chloro-4,5-dimethoxyphenyl)methylideneamino]benzenesulfonamide |
|---|---|
| PubChem CID | 1001980 |
| Molecular Formula | C15H15ClN2O4S |
| Molecular Weight | 354.82 g/mol |
| Exact Mass | 354.04 |
| IUPAC Name | N-[(2-chloro-4,5-dimethoxyphenyl)methylideneamino]benzenesulfonamide |
| SMILES | COc1cc(Cl)c(C=NNS(=O)(=O)c2ccccc2)cc1OC |
| InChI | InChI=1S/C15H15ClN2O4S/c1-21-14-8-11(13(16)9-15(14)22-2)10-17-18-23(19,20)12-6-4-3-5-7-12/h3-10,18H,1-2H3 |
| InChIKey | PXHAZASZDONJMB-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.82 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|