C17H19ClN2O6S — CID 110517529
N-[(E)-(2-chloro-3,4-dimethoxyphenyl)methylideneamino]-3,4-dimethoxybenzenesulfonamide (PubChem CID 110517529) has the molecular formula C17H19ClN2O6S and a molecular weight of 414.87 g/mol. Its IUPAC name is N-[(E)-(2-chloro-3,4-dimethoxyphenyl)methylideneamino]-3,4-dimethoxybenzenesulfonamide.
| Compound Name | N-[(E)-(2-chloro-3,4-dimethoxyphenyl)methylideneamino]-3,4-dimethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 110517529 |
| Molecular Formula | C17H19ClN2O6S |
| Molecular Weight | 414.87 g/mol |
| Exact Mass | 414.07 |
| IUPAC Name | N-[(E)-(2-chloro-3,4-dimethoxyphenyl)methylideneamino]-3,4-dimethoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)N/N=C/c2ccc(OC)c(OC)c2Cl)cc1OC |
| InChI | InChI=1S/C17H19ClN2O6S/c1-23-13-8-6-12(9-15(13)25-3)27(21,22)20-19-10-11-5-7-14(24-2)17(26-4)16(11)18/h5-10,20H,1-4H3/b19-10+ |
| InChIKey | KFVDUPAXBGVQSJ-VXLYETTFSA-N |
| XLogP | 2.69 |
| TPSA | 95.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.87 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|