C17H20N2O7S — CID 135873358
N-[(E)-(4-hydroxy-3,5-dimethoxyphenyl)methylideneamino]-3,4-dimethoxybenzenesulfonamide (PubChem CID 135873358) has the molecular formula C17H20N2O7S and a molecular weight of 396.42 g/mol. Its IUPAC name is N-[(E)-(4-hydroxy-3,5-dimethoxyphenyl)methylideneamino]-3,4-dimethoxybenzenesulfonamide.
| Compound Name | N-[(E)-(4-hydroxy-3,5-dimethoxyphenyl)methylideneamino]-3,4-dimethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 135873358 |
| Molecular Formula | C17H20N2O7S |
| Molecular Weight | 396.42 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | N-[(E)-(4-hydroxy-3,5-dimethoxyphenyl)methylideneamino]-3,4-dimethoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)N/N=C/c2cc(OC)c(O)c(OC)c2)cc1OC |
| InChI | InChI=1S/C17H20N2O7S/c1-23-13-6-5-12(9-14(13)24-2)27(21,22)19-18-10-11-7-15(25-3)17(20)16(8-11)26-4/h5-10,19-20H,1-4H3/b18-10+ |
| InChIKey | QGAHFKDVUNPBQV-VCHYOVAHSA-N |
| XLogP | 1.74 |
| TPSA | 115.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.42 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|