C13H14N2O5S2 — CID 136873643
N-[(E)-(4-hydroxy-3,5-dimethoxyphenyl)methylideneamino]thiophene-2-sulfonamide (PubChem CID 136873643) has the molecular formula C13H14N2O5S2 and a molecular weight of 342.40 g/mol. Its IUPAC name is N-[(E)-(4-hydroxy-3,5-dimethoxyphenyl)methylideneamino]thiophene-2-sulfonamide.
| Compound Name | N-[(E)-(4-hydroxy-3,5-dimethoxyphenyl)methylideneamino]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 136873643 |
| Molecular Formula | C13H14N2O5S2 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.03 |
| IUPAC Name | N-[(E)-(4-hydroxy-3,5-dimethoxyphenyl)methylideneamino]thiophene-2-sulfonamide |
| SMILES | COc1cc(/C=N/NS(=O)(=O)c2cccs2)cc(OC)c1O |
| InChI | InChI=1S/C13H14N2O5S2/c1-19-10-6-9(7-11(20-2)13(10)16)8-14-15-22(17,18)12-4-3-5-21-12/h3-8,15-16H,1-2H3/b14-8+ |
| InChIKey | PWYWXFXNSLTQSW-RIYZIHGNSA-N |
| XLogP | 1.78 |
| TPSA | 97.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|