C19H25N3O5S2 — CID 110518118
2-[2-ethoxy-4-[(E)-(thiophen-2-ylsulfonylhydrazinylidene)methyl]phenoxy]-N,N-diethylacetamide (PubChem CID 110518118) has the molecular formula C19H25N3O5S2 and a molecular weight of 439.56 g/mol. Its IUPAC name is 2-[2-ethoxy-4-[(E)-(thiophen-2-ylsulfonylhydrazinylidene)methyl]phenoxy]-N,N-diethylacetamide.
| Compound Name | 2-[2-ethoxy-4-[(E)-(thiophen-2-ylsulfonylhydrazinylidene)methyl]phenoxy]-N,N-diethylacetamide |
|---|---|
| PubChem CID | 110518118 |
| Molecular Formula | C19H25N3O5S2 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.12 |
| IUPAC Name | 2-[2-ethoxy-4-[(E)-(thiophen-2-ylsulfonylhydrazinylidene)methyl]phenoxy]-N,N-diethylacetamide |
| SMILES | CCOc1cc(/C=N/NS(=O)(=O)c2cccs2)ccc1OCC(=O)N(CC)CC |
| InChI | InChI=1S/C19H25N3O5S2/c1-4-22(5-2)18(23)14-27-16-10-9-15(12-17(16)26-6-3)13-20-21-29(24,25)19-8-7-11-28-19/h7-13,21H,4-6,14H2,1-3H3/b20-13+ |
| InChIKey | DXEOZXDRAYTVPP-DEDYPNTBSA-N |
| XLogP | 2.71 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|