C14H16N2O3S2 — CID 110518275
N-[(E)-(2-propoxyphenyl)methylideneamino]thiophene-2-sulfonamide (PubChem CID 110518275) has the molecular formula C14H16N2O3S2 and a molecular weight of 324.43 g/mol. Its IUPAC name is N-[(E)-(2-propoxyphenyl)methylideneamino]thiophene-2-sulfonamide.
| Compound Name | N-[(E)-(2-propoxyphenyl)methylideneamino]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 110518275 |
| Molecular Formula | C14H16N2O3S2 |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.06 |
| IUPAC Name | N-[(E)-(2-propoxyphenyl)methylideneamino]thiophene-2-sulfonamide |
| SMILES | CCCOc1ccccc1/C=N/NS(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C14H16N2O3S2/c1-2-9-19-13-7-4-3-6-12(13)11-15-16-21(17,18)14-8-5-10-20-14/h3-8,10-11,16H,2,9H2,1H3/b15-11+ |
| InChIKey | BLWOVUCGDCPUGN-RVDMUPIBSA-N |
| XLogP | 2.85 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|