C11H8Cl2N2O2S2 — CID 12704246
N-[(E)-(2,6-dichlorophenyl)methylideneamino]thiophene-2-sulfonamide (PubChem CID 12704246) has the molecular formula C11H8Cl2N2O2S2 and a molecular weight of 335.24 g/mol. Its IUPAC name is N-[(E)-(2,6-dichlorophenyl)methylideneamino]thiophene-2-sulfonamide.
| Compound Name | N-[(E)-(2,6-dichlorophenyl)methylideneamino]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 12704246 |
| Molecular Formula | C11H8Cl2N2O2S2 |
| Molecular Weight | 335.24 g/mol |
| Exact Mass | 333.94 |
| IUPAC Name | N-[(E)-(2,6-dichlorophenyl)methylideneamino]thiophene-2-sulfonamide |
| SMILES | O=S(=O)(N/N=C/c1c(Cl)cccc1Cl)c1cccs1 |
| InChI | InChI=1S/C11H8Cl2N2O2S2/c12-9-3-1-4-10(13)8(9)7-14-15-19(16,17)11-5-2-6-18-11/h1-7,15H/b14-7+ |
| InChIKey | FBAOEUMZHKUPIG-VGOFMYFVSA-N |
| XLogP | 3.37 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.24 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|