C12H11ClN2O4S2 — CID 110518258
N-[(E)-(2-chloro-3-hydroxy-4-methoxyphenyl)methylideneamino]thiophene-2-sulfonamide (PubChem CID 110518258) has the molecular formula C12H11ClN2O4S2 and a molecular weight of 346.82 g/mol. Its IUPAC name is N-[(E)-(2-chloro-3-hydroxy-4-methoxyphenyl)methylideneamino]thiophene-2-sulfonamide.
| Compound Name | N-[(E)-(2-chloro-3-hydroxy-4-methoxyphenyl)methylideneamino]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 110518258 |
| Molecular Formula | C12H11ClN2O4S2 |
| Molecular Weight | 346.82 g/mol |
| Exact Mass | 345.98 |
| IUPAC Name | N-[(E)-(2-chloro-3-hydroxy-4-methoxyphenyl)methylideneamino]thiophene-2-sulfonamide |
| SMILES | COc1ccc(/C=N/NS(=O)(=O)c2cccs2)c(Cl)c1O |
| InChI | InChI=1S/C12H11ClN2O4S2/c1-19-9-5-4-8(11(13)12(9)16)7-14-15-21(17,18)10-3-2-6-20-10/h2-7,15-16H,1H3/b14-7+ |
| InChIKey | MTTLLRVUCGNDBA-VGOFMYFVSA-N |
| XLogP | 2.43 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.82 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|