C9H11ClN2O2 — CID 110839630
2-chloro-6-methoxy-3-[(methylhydrazinylidene)methyl]phenol (PubChem CID 110839630) has the molecular formula C9H11ClN2O2 and a molecular weight of 214.65 g/mol. Its IUPAC name is 2-chloro-6-methoxy-3-[(methylhydrazinylidene)methyl]phenol.
| Compound Name | 2-chloro-6-methoxy-3-[(methylhydrazinylidene)methyl]phenol |
|---|---|
| PubChem CID | 110839630 |
| Molecular Formula | C9H11ClN2O2 |
| Molecular Weight | 214.65 g/mol |
| Exact Mass | 214.05 |
| IUPAC Name | 2-chloro-6-methoxy-3-[(methylhydrazinylidene)methyl]phenol |
| SMILES | CNN=Cc1ccc(OC)c(O)c1Cl |
| InChI | InChI=1S/C9H11ClN2O2/c1-11-12-5-6-3-4-7(14-2)9(13)8(6)10/h3-5,11,13H,1-2H3 |
| InChIKey | FQBBEVDXPROBMN-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.65 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|