C15H21ClN4O3S — CID 110508502
1-[(E)-(2-chloro-3-hydroxy-4-methoxyphenyl)methylideneamino]-3-(2-morpholin-4-ylethyl)thiourea (PubChem CID 110508502) has the molecular formula C15H21ClN4O3S and a molecular weight of 372.88 g/mol. Its IUPAC name is 1-[(E)-(2-chloro-3-hydroxy-4-methoxyphenyl)methylideneamino]-3-(2-morpholin-4-ylethyl)thiourea.
| Compound Name | 1-[(E)-(2-chloro-3-hydroxy-4-methoxyphenyl)methylideneamino]-3-(2-morpholin-4-ylethyl)thiourea |
|---|---|
| PubChem CID | 110508502 |
| Molecular Formula | C15H21ClN4O3S |
| Molecular Weight | 372.88 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | 1-[(E)-(2-chloro-3-hydroxy-4-methoxyphenyl)methylideneamino]-3-(2-morpholin-4-ylethyl)thiourea |
| SMILES | COc1ccc(/C=N/NC(=S)NCCN2CCOCC2)c(Cl)c1O |
| InChI | InChI=1S/C15H21ClN4O3S/c1-22-12-3-2-11(13(16)14(12)21)10-18-19-15(24)17-4-5-20-6-8-23-9-7-20/h2-3,10,21H,4-9H2,1H3,(H2,17,19,24)/b18-10+ |
| InChIKey | CRLPDYPXDHOGRT-VCHYOVAHSA-N |
| XLogP | 1.18 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.88 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|