C17H26N4O4S — CID 2369734
1-(2-morpholin-4-ylethyl)-3-[(2,4,5-trimethoxyphenyl)methylideneamino]thiourea (PubChem CID 2369734) has the molecular formula C17H26N4O4S and a molecular weight of 382.49 g/mol. Its IUPAC name is 1-(2-morpholin-4-ylethyl)-3-[(2,4,5-trimethoxyphenyl)methylideneamino]thiourea.
| Compound Name | 1-(2-morpholin-4-ylethyl)-3-[(2,4,5-trimethoxyphenyl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 2369734 |
| Molecular Formula | C17H26N4O4S |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | 1-(2-morpholin-4-ylethyl)-3-[(2,4,5-trimethoxyphenyl)methylideneamino]thiourea |
| SMILES | COc1cc(OC)c(OC)cc1C=NNC(=S)NCCN1CCOCC1 |
| InChI | InChI=1S/C17H26N4O4S/c1-22-14-11-16(24-3)15(23-2)10-13(14)12-19-20-17(26)18-4-5-21-6-8-25-9-7-21/h10-12H,4-9H2,1-3H3,(H2,18,20,26) |
| InChIKey | SRIKJKMOLSVPQI-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|