C17H24F2N4O3S — CID 9411675
1-[(Z)-[4-(difluoromethoxy)-3-methoxyphenyl]methylideneamino]-3-(3-morpholin-4-ylpropyl)thiourea (PubChem CID 9411675) has the molecular formula C17H24F2N4O3S and a molecular weight of 402.47 g/mol. Its IUPAC name is 1-[(Z)-[4-(difluoromethoxy)-3-methoxyphenyl]methylideneamino]-3-(3-morpholin-4-ylpropyl)thiourea.
| Compound Name | 1-[(Z)-[4-(difluoromethoxy)-3-methoxyphenyl]methylideneamino]-3-(3-morpholin-4-ylpropyl)thiourea |
|---|---|
| PubChem CID | 9411675 |
| Molecular Formula | C17H24F2N4O3S |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | 1-[(Z)-[4-(difluoromethoxy)-3-methoxyphenyl]methylideneamino]-3-(3-morpholin-4-ylpropyl)thiourea |
| SMILES | COc1cc(/C=N\NC(=S)NCCCN2CCOCC2)ccc1OC(F)F |
| InChI | InChI=1S/C17H24F2N4O3S/c1-24-15-11-13(3-4-14(15)26-16(18)19)12-21-22-17(27)20-5-2-6-23-7-9-25-10-8-23/h3-4,11-12,16H,2,5-10H2,1H3,(H2,20,22,27)/b21-12- |
| InChIKey | UXLOTXFJAPBICR-MTJSOVHGSA-N |
| XLogP | 1.82 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|