C15H20F2N4OS — CID 9411568
1-[(Z)-(2,6-difluorophenyl)methylideneamino]-3-(3-morpholin-4-ylpropyl)thiourea (PubChem CID 9411568) has the molecular formula C15H20F2N4OS and a molecular weight of 342.42 g/mol. Its IUPAC name is 1-[(Z)-(2,6-difluorophenyl)methylideneamino]-3-(3-morpholin-4-ylpropyl)thiourea.
| Compound Name | 1-[(Z)-(2,6-difluorophenyl)methylideneamino]-3-(3-morpholin-4-ylpropyl)thiourea |
|---|---|
| PubChem CID | 9411568 |
| Molecular Formula | C15H20F2N4OS |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | 1-[(Z)-(2,6-difluorophenyl)methylideneamino]-3-(3-morpholin-4-ylpropyl)thiourea |
| SMILES | Fc1cccc(F)c1/C=N\NC(=S)NCCCN1CCOCC1 |
| InChI | InChI=1S/C15H20F2N4OS/c16-13-3-1-4-14(17)12(13)11-19-20-15(23)18-5-2-6-21-7-9-22-10-8-21/h1,3-4,11H,2,5-10H2,(H2,18,20,23)/b19-11- |
| InChIKey | BEHDYVQGTQYLRA-ODLFYWEKSA-N |
| XLogP | 1.49 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|