C16H21F3N4OS — CID 9411411
1-(3-morpholin-4-ylpropyl)-3-[(Z)-[2-(trifluoromethyl)phenyl]methylideneamino]thiourea (PubChem CID 9411411) has the molecular formula C16H21F3N4OS and a molecular weight of 374.43 g/mol. Its IUPAC name is 1-(3-morpholin-4-ylpropyl)-3-[(Z)-[2-(trifluoromethyl)phenyl]methylideneamino]thiourea.
| Compound Name | 1-(3-morpholin-4-ylpropyl)-3-[(Z)-[2-(trifluoromethyl)phenyl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 9411411 |
| Molecular Formula | C16H21F3N4OS |
| Molecular Weight | 374.43 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | 1-(3-morpholin-4-ylpropyl)-3-[(Z)-[2-(trifluoromethyl)phenyl]methylideneamino]thiourea |
| SMILES | FC(F)(F)c1ccccc1/C=N\NC(=S)NCCCN1CCOCC1 |
| InChI | InChI=1S/C16H21F3N4OS/c17-16(18,19)14-5-2-1-4-13(14)12-21-22-15(25)20-6-3-7-23-8-10-24-11-9-23/h1-2,4-5,12H,3,6-11H2,(H2,20,22,25)/b21-12- |
| InChIKey | SAAKKCPGZMNIMW-MTJSOVHGSA-N |
| XLogP | 2.23 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.43 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|