C15H20Cl2N4OS — CID 9411374
1-[(Z)-(3,4-dichlorophenyl)methylideneamino]-3-(3-morpholin-4-ylpropyl)thiourea (PubChem CID 9411374) has the molecular formula C15H20Cl2N4OS and a molecular weight of 375.33 g/mol. Its IUPAC name is 1-[(Z)-(3,4-dichlorophenyl)methylideneamino]-3-(3-morpholin-4-ylpropyl)thiourea.
| Compound Name | 1-[(Z)-(3,4-dichlorophenyl)methylideneamino]-3-(3-morpholin-4-ylpropyl)thiourea |
|---|---|
| PubChem CID | 9411374 |
| Molecular Formula | C15H20Cl2N4OS |
| Molecular Weight | 375.33 g/mol |
| Exact Mass | 374.07 |
| IUPAC Name | 1-[(Z)-(3,4-dichlorophenyl)methylideneamino]-3-(3-morpholin-4-ylpropyl)thiourea |
| SMILES | S=C(NCCCN1CCOCC1)N/N=C\c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H20Cl2N4OS/c16-13-3-2-12(10-14(13)17)11-19-20-15(23)18-4-1-5-21-6-8-22-9-7-21/h2-3,10-11H,1,4-9H2,(H2,18,20,23)/b19-11- |
| InChIKey | GLVYATSDNZJTQV-ODLFYWEKSA-N |
| XLogP | 2.51 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.33 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|