C26H32Cl4N8S2 — CID 54606078
1-[(E)-(2,4-dichlorophenyl)methylideneamino]-3-[3-[4-[3-[[(Z)-(2,4-dichlorophenyl)methylideneamino]carbamothioylamino]propyl]piperazin-1-yl]propyl]thiourea (PubChem CID 54606078) has the molecular formula C26H32Cl4N8S2 and a molecular weight of 662.54 g/mol. Its IUPAC name is 1-[(E)-(2,4-dichlorophenyl)methylideneamino]-3-[3-[4-[3-[[(Z)-(2,4-dichlorophenyl)methylideneamino]carbamothioylamino]propyl]piperazin-1-yl]propyl]thiourea.
| Compound Name | 1-[(E)-(2,4-dichlorophenyl)methylideneamino]-3-[3-[4-[3-[[(Z)-(2,4-dichlorophenyl)methylideneamino]carbamothioylamino]propyl]piperazin-1-yl]propyl]thiourea |
|---|---|
| PubChem CID | 54606078 |
| Molecular Formula | C26H32Cl4N8S2 |
| Molecular Weight | 662.54 g/mol |
| Exact Mass | 660.09 |
| IUPAC Name | 1-[(E)-(2,4-dichlorophenyl)methylideneamino]-3-[3-[4-[3-[[(Z)-(2,4-dichlorophenyl)methylideneamino]carbamothioylamino]propyl]piperazin-1-yl]propyl]thiourea |
| SMILES | S=C(NCCCN1CCN(CCCNC(=S)N/N=C/c2ccc(Cl)cc2Cl)CC1)N/N=C\c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C26H32Cl4N8S2/c27-21-5-3-19(23(29)15-21)17-33-35-25(39)31-7-1-9-37-11-13-38(14-12-37)10-2-8-32-26(40)36-34-18-20-4-6-22(28)16-24(20)30/h3-6,15-18H,1-2,7-14H2,(H2,31,35,39)(H2,32,36,40)/b33-17-,34-18+ |
| InChIKey | HPUDPGZOJUMSQM-ZAYSQSOWSA-N |
| XLogP | 4.99 |
| TPSA | 79.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.54 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|