C22H22Cl4N4O2 — CID 4154213
N,N'-bis[(2,4-dichlorophenyl)methylideneamino]octanediamide (PubChem CID 4154213) has the molecular formula C22H22Cl4N4O2 and a molecular weight of 516.26 g/mol. Its IUPAC name is N,N'-bis[(2,4-dichlorophenyl)methylideneamino]octanediamide.
| Compound Name | N,N'-bis[(2,4-dichlorophenyl)methylideneamino]octanediamide |
|---|---|
| PubChem CID | 4154213 |
| Molecular Formula | C22H22Cl4N4O2 |
| Molecular Weight | 516.26 g/mol |
| Exact Mass | 514.05 |
| IUPAC Name | N,N'-bis[(2,4-dichlorophenyl)methylideneamino]octanediamide |
| SMILES | O=C(CCCCCCC(=O)NN=Cc1ccc(Cl)cc1Cl)NN=Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C22H22Cl4N4O2/c23-17-9-7-15(19(25)11-17)13-27-29-21(31)5-3-1-2-4-6-22(32)30-28-14-16-8-10-18(24)12-20(16)26/h7-14H,1-6H2,(H,29,31)(H,30,32) |
| InChIKey | PXYRAJWJYAQPBZ-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.26 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|