C16H19Cl2N3O2 — CID 1098758
N-cyclohexyl-N'-[(2,4-dichlorophenyl)methylideneamino]propanediamide (PubChem CID 1098758) has the molecular formula C16H19Cl2N3O2 and a molecular weight of 356.25 g/mol. Its IUPAC name is N-cyclohexyl-N'-[(2,4-dichlorophenyl)methylideneamino]propanediamide.
| Compound Name | N-cyclohexyl-N'-[(2,4-dichlorophenyl)methylideneamino]propanediamide |
|---|---|
| PubChem CID | 1098758 |
| Molecular Formula | C16H19Cl2N3O2 |
| Molecular Weight | 356.25 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | N-cyclohexyl-N'-[(2,4-dichlorophenyl)methylideneamino]propanediamide |
| SMILES | O=C(CC(=O)NC1CCCCC1)NN=Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H19Cl2N3O2/c17-12-7-6-11(14(18)8-12)10-19-21-16(23)9-15(22)20-13-4-2-1-3-5-13/h6-8,10,13H,1-5,9H2,(H,20,22)(H,21,23) |
| InChIKey | AMWGYEDYLWFGMU-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.25 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|