C15H9Cl5N2O2 — CID 3546155
N-[(2,4-dichlorophenyl)methylideneamino]-2-(2,4,5-trichlorophenoxy)acetamide (PubChem CID 3546155) has the molecular formula C15H9Cl5N2O2 and a molecular weight of 426.51 g/mol. Its IUPAC name is N-[(2,4-dichlorophenyl)methylideneamino]-2-(2,4,5-trichlorophenoxy)acetamide.
| Compound Name | N-[(2,4-dichlorophenyl)methylideneamino]-2-(2,4,5-trichlorophenoxy)acetamide |
|---|---|
| PubChem CID | 3546155 |
| Molecular Formula | C15H9Cl5N2O2 |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 423.91 |
| IUPAC Name | N-[(2,4-dichlorophenyl)methylideneamino]-2-(2,4,5-trichlorophenoxy)acetamide |
| SMILES | O=C(COc1cc(Cl)c(Cl)cc1Cl)NN=Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H9Cl5N2O2/c16-9-2-1-8(10(17)3-9)6-21-22-15(23)7-24-14-5-12(19)11(18)4-13(14)20/h1-6H,7H2,(H,22,23) |
| InChIKey | GDVDIHDLLPSBEW-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|