C15H11Cl3N2O3 — CID 136794072
N-[(Z)-(2-hydroxyphenyl)methylideneamino]-2-(2,4,5-trichlorophenoxy)acetamide (PubChem CID 136794072) has the molecular formula C15H11Cl3N2O3 and a molecular weight of 373.62 g/mol. Its IUPAC name is N-[(Z)-(2-hydroxyphenyl)methylideneamino]-2-(2,4,5-trichlorophenoxy)acetamide.
| Compound Name | N-[(Z)-(2-hydroxyphenyl)methylideneamino]-2-(2,4,5-trichlorophenoxy)acetamide |
|---|---|
| PubChem CID | 136794072 |
| Molecular Formula | C15H11Cl3N2O3 |
| Molecular Weight | 373.62 g/mol |
| Exact Mass | 371.98 |
| IUPAC Name | N-[(Z)-(2-hydroxyphenyl)methylideneamino]-2-(2,4,5-trichlorophenoxy)acetamide |
| SMILES | O=C(COc1cc(Cl)c(Cl)cc1Cl)N/N=C\c1ccccc1O |
| InChI | InChI=1S/C15H11Cl3N2O3/c16-10-5-12(18)14(6-11(10)17)23-8-15(22)20-19-7-9-3-1-2-4-13(9)21/h1-7,21H,8H2,(H,20,22)/b19-7- |
| InChIKey | BBKVUKYKHFUCPD-GXHLCREISA-N |
| XLogP | 3.88 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.62 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|