C19H20Cl3N3O3 — CID 135647094
N-[(E)-[4-(diethylamino)-2-hydroxyphenyl]methylideneamino]-2-(2,4,5-trichlorophenoxy)acetamide (PubChem CID 135647094) has the molecular formula C19H20Cl3N3O3 and a molecular weight of 444.75 g/mol. Its IUPAC name is N-[(E)-[4-(diethylamino)-2-hydroxyphenyl]methylideneamino]-2-(2,4,5-trichlorophenoxy)acetamide.
| Compound Name | N-[(E)-[4-(diethylamino)-2-hydroxyphenyl]methylideneamino]-2-(2,4,5-trichlorophenoxy)acetamide |
|---|---|
| PubChem CID | 135647094 |
| Molecular Formula | C19H20Cl3N3O3 |
| Molecular Weight | 444.75 g/mol |
| Exact Mass | 443.06 |
| IUPAC Name | N-[(E)-[4-(diethylamino)-2-hydroxyphenyl]methylideneamino]-2-(2,4,5-trichlorophenoxy)acetamide |
| SMILES | CCN(CC)c1ccc(/C=N/NC(=O)COc2cc(Cl)c(Cl)cc2Cl)c(O)c1 |
| InChI | InChI=1S/C19H20Cl3N3O3/c1-3-25(4-2)13-6-5-12(17(26)7-13)10-23-24-19(27)11-28-18-9-15(21)14(20)8-16(18)22/h5-10,26H,3-4,11H2,1-2H3,(H,24,27)/b23-10+ |
| InChIKey | WLZKFOZZUXLCKR-AUEPDCJTSA-N |
| XLogP | 4.73 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.75 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|