C21H25ClN4O3 — CID 5241480
N-(2-chlorophenyl)-N'-[[4-(diethylamino)-2-hydroxyphenyl]methylideneamino]butanediamide (PubChem CID 5241480) has the molecular formula C21H25ClN4O3 and a molecular weight of 416.91 g/mol. Its IUPAC name is N-(2-chlorophenyl)-N'-[[4-(diethylamino)-2-hydroxyphenyl]methylideneamino]butanediamide.
| Compound Name | N-(2-chlorophenyl)-N'-[[4-(diethylamino)-2-hydroxyphenyl]methylideneamino]butanediamide |
|---|---|
| PubChem CID | 5241480 |
| Molecular Formula | C21H25ClN4O3 |
| Molecular Weight | 416.91 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | N-(2-chlorophenyl)-N'-[[4-(diethylamino)-2-hydroxyphenyl]methylideneamino]butanediamide |
| SMILES | CCN(CC)c1ccc(C=NNC(=O)CCC(=O)Nc2ccccc2Cl)c(O)c1 |
| InChI | InChI=1S/C21H25ClN4O3/c1-3-26(4-2)16-10-9-15(19(27)13-16)14-23-25-21(29)12-11-20(28)24-18-8-6-5-7-17(18)22/h5-10,13-14,27H,3-4,11-12H2,1-2H3,(H,24,28)(H,25,29) |
| InChIKey | KRHKMHACRJSZQP-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.91 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|