C16H12BrCl3N2O3 — CID 4175101
N-[(5-bromo-2-methoxyphenyl)methylideneamino]-2-(2,4,5-trichlorophenoxy)acetamide (PubChem CID 4175101) has the molecular formula C16H12BrCl3N2O3 and a molecular weight of 466.55 g/mol. Its IUPAC name is N-[(5-bromo-2-methoxyphenyl)methylideneamino]-2-(2,4,5-trichlorophenoxy)acetamide.
| Compound Name | N-[(5-bromo-2-methoxyphenyl)methylideneamino]-2-(2,4,5-trichlorophenoxy)acetamide |
|---|---|
| PubChem CID | 4175101 |
| Molecular Formula | C16H12BrCl3N2O3 |
| Molecular Weight | 466.55 g/mol |
| Exact Mass | 463.91 |
| IUPAC Name | N-[(5-bromo-2-methoxyphenyl)methylideneamino]-2-(2,4,5-trichlorophenoxy)acetamide |
| SMILES | COc1ccc(Br)cc1C=NNC(=O)COc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C16H12BrCl3N2O3/c1-24-14-3-2-10(17)4-9(14)7-21-22-16(23)8-25-15-6-12(19)11(18)5-13(15)20/h2-7H,8H2,1H3,(H,22,23) |
| InChIKey | RPGXKDGPXFEVNE-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.55 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|