C17H17BrN3O5- — CID 172986252
[2-[2-[(2E)-2-[(5-bromo-2-methoxyphenyl)methylidene]hydrazinyl]-2-oxoethoxy]-5-methylphenyl]-dioxidoazanium (PubChem CID 172986252) has the molecular formula C17H17BrN3O5- and a molecular weight of 423.24 g/mol. Its IUPAC name is [2-[2-[(2E)-2-[(5-bromo-2-methoxyphenyl)methylidene]hydrazinyl]-2-oxoethoxy]-5-methylphenyl]-dioxidoazanium.
| Compound Name | [2-[2-[(2E)-2-[(5-bromo-2-methoxyphenyl)methylidene]hydrazinyl]-2-oxoethoxy]-5-methylphenyl]-dioxidoazanium |
|---|---|
| PubChem CID | 172986252 |
| Molecular Formula | C17H17BrN3O5- |
| Molecular Weight | 423.24 g/mol |
| Exact Mass | 422.04 |
| IUPAC Name | [2-[2-[(2E)-2-[(5-bromo-2-methoxyphenyl)methylidene]hydrazinyl]-2-oxoethoxy]-5-methylphenyl]-dioxidoazanium |
| SMILES | COc1ccc(Br)cc1/C=N/NC(=O)COc1ccc(C)cc1[NH+]([O-])[O-] |
| InChI | InChI=1S/C17H17BrN3O5/c1-11-3-5-16(14(7-11)21(23)24)26-10-17(22)20-19-9-12-8-13(18)4-6-15(12)25-2/h3-9,21H,10H2,1-2H3,(H,20,22)/q-1/b19-9+ |
| InChIKey | RWQGXSQGMNZSEV-DJKKODMXSA-N |
| XLogP | 1.81 |
| TPSA | 110.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.24 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|