C17H16BrClN2O3 — CID 4631727
2-(4-bromo-2-chlorophenoxy)-N-[(2-ethoxyphenyl)methylideneamino]acetamide (PubChem CID 4631727) has the molecular formula C17H16BrClN2O3 and a molecular weight of 411.68 g/mol. Its IUPAC name is 2-(4-bromo-2-chlorophenoxy)-N-[(2-ethoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-(4-bromo-2-chlorophenoxy)-N-[(2-ethoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 4631727 |
| Molecular Formula | C17H16BrClN2O3 |
| Molecular Weight | 411.68 g/mol |
| Exact Mass | 410.00 |
| IUPAC Name | 2-(4-bromo-2-chlorophenoxy)-N-[(2-ethoxyphenyl)methylideneamino]acetamide |
| SMILES | CCOc1ccccc1C=NNC(=O)COc1ccc(Br)cc1Cl |
| InChI | InChI=1S/C17H16BrClN2O3/c1-2-23-15-6-4-3-5-12(15)10-20-21-17(22)11-24-16-8-7-13(18)9-14(16)19/h3-10H,2,11H2,1H3,(H,21,22) |
| InChIKey | CIPOKUTVLNLSOC-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.68 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|