C19H17Cl3N2O5 — CID 5440418
ethyl 2-[2-[(Z)-[[2-(2,4,6-trichlorophenoxy)acetyl]hydrazinylidene]methyl]phenoxy]acetate (PubChem CID 5440418) has the molecular formula C19H17Cl3N2O5 and a molecular weight of 459.71 g/mol. Its IUPAC name is ethyl 2-[2-[(Z)-[[2-(2,4,6-trichlorophenoxy)acetyl]hydrazinylidene]methyl]phenoxy]acetate.
| Compound Name | ethyl 2-[2-[(Z)-[[2-(2,4,6-trichlorophenoxy)acetyl]hydrazinylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 5440418 |
| Molecular Formula | C19H17Cl3N2O5 |
| Molecular Weight | 459.71 g/mol |
| Exact Mass | 458.02 |
| IUPAC Name | ethyl 2-[2-[(Z)-[[2-(2,4,6-trichlorophenoxy)acetyl]hydrazinylidene]methyl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1ccccc1/C=N\NC(=O)COc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C19H17Cl3N2O5/c1-2-27-18(26)11-28-16-6-4-3-5-12(16)9-23-24-17(25)10-29-19-14(21)7-13(20)8-15(19)22/h3-9H,2,10-11H2,1H3,(H,24,25)/b23-9- |
| InChIKey | JVMDOBVTKHRTMP-AQHIEDMUSA-N |
| XLogP | 4.12 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.71 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|