C18H18Cl2N2O2 — CID 94838608
2-(2,4-dichlorophenoxy)-N-[(Z)-(2,3,4-trimethylphenyl)methylideneamino]acetamide (PubChem CID 94838608) has the molecular formula C18H18Cl2N2O2 and a molecular weight of 365.26 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-N-[(Z)-(2,3,4-trimethylphenyl)methylideneamino]acetamide.
| Compound Name | 2-(2,4-dichlorophenoxy)-N-[(Z)-(2,3,4-trimethylphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 94838608 |
| Molecular Formula | C18H18Cl2N2O2 |
| Molecular Weight | 365.26 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-N-[(Z)-(2,3,4-trimethylphenyl)methylideneamino]acetamide |
| SMILES | Cc1ccc(/C=N\NC(=O)COc2ccc(Cl)cc2Cl)c(C)c1C |
| InChI | InChI=1S/C18H18Cl2N2O2/c1-11-4-5-14(13(3)12(11)2)9-21-22-18(23)10-24-17-7-6-15(19)8-16(17)20/h4-9H,10H2,1-3H3,(H,22,23)/b21-9- |
| InChIKey | HSQWJVVCDHPEKK-NKVSQWTQSA-N |
| XLogP | 4.45 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.26 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|