C16H13Cl3N2O3 — CID 7332440
N-[(Z)-(3-chloro-4-methoxyphenyl)methylideneamino]-2-(2,4-dichlorophenoxy)acetamide (PubChem CID 7332440) has the molecular formula C16H13Cl3N2O3 and a molecular weight of 387.65 g/mol. Its IUPAC name is N-[(Z)-(3-chloro-4-methoxyphenyl)methylideneamino]-2-(2,4-dichlorophenoxy)acetamide.
| Compound Name | N-[(Z)-(3-chloro-4-methoxyphenyl)methylideneamino]-2-(2,4-dichlorophenoxy)acetamide |
|---|---|
| PubChem CID | 7332440 |
| Molecular Formula | C16H13Cl3N2O3 |
| Molecular Weight | 387.65 g/mol |
| Exact Mass | 386.00 |
| IUPAC Name | N-[(Z)-(3-chloro-4-methoxyphenyl)methylideneamino]-2-(2,4-dichlorophenoxy)acetamide |
| SMILES | COc1ccc(/C=N\NC(=O)COc2ccc(Cl)cc2Cl)cc1Cl |
| InChI | InChI=1S/C16H13Cl3N2O3/c1-23-14-4-2-10(6-12(14)18)8-20-21-16(22)9-24-15-5-3-11(17)7-13(15)19/h2-8H,9H2,1H3,(H,21,22)/b20-8- |
| InChIKey | GZEUFFWZGZDRKK-ZBKNUEDVSA-N |
| XLogP | 4.18 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.65 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|