C15H12Cl2N2O3 — CID 6870038
2-(2,4-dichlorophenoxy)-N-[(E)-(3-hydroxyphenyl)methylideneamino]acetamide (PubChem CID 6870038) has the molecular formula C15H12Cl2N2O3 and a molecular weight of 339.18 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-N-[(E)-(3-hydroxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-(2,4-dichlorophenoxy)-N-[(E)-(3-hydroxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 6870038 |
| Molecular Formula | C15H12Cl2N2O3 |
| Molecular Weight | 339.18 g/mol |
| Exact Mass | 338.02 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-N-[(E)-(3-hydroxyphenyl)methylideneamino]acetamide |
| SMILES | O=C(COc1ccc(Cl)cc1Cl)N/N=C/c1cccc(O)c1 |
| InChI | InChI=1S/C15H12Cl2N2O3/c16-11-4-5-14(13(17)7-11)22-9-15(21)19-18-8-10-2-1-3-12(20)6-10/h1-8,20H,9H2,(H,19,21)/b18-8+ |
| InChIKey | GAFQLIXZXYJHLH-QGMBQPNBSA-N |
| XLogP | 3.23 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.18 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|