C15H11Cl2IN2O3 — CID 136718750
2-(2,4-dichlorophenoxy)-N-[(Z)-(4-hydroxy-3-iodophenyl)methylideneamino]acetamide (PubChem CID 136718750) has the molecular formula C15H11Cl2IN2O3 and a molecular weight of 465.07 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-N-[(Z)-(4-hydroxy-3-iodophenyl)methylideneamino]acetamide.
| Compound Name | 2-(2,4-dichlorophenoxy)-N-[(Z)-(4-hydroxy-3-iodophenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 136718750 |
| Molecular Formula | C15H11Cl2IN2O3 |
| Molecular Weight | 465.07 g/mol |
| Exact Mass | 463.92 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-N-[(Z)-(4-hydroxy-3-iodophenyl)methylideneamino]acetamide |
| SMILES | O=C(COc1ccc(Cl)cc1Cl)N/N=C\c1ccc(O)c(I)c1 |
| InChI | InChI=1S/C15H11Cl2IN2O3/c16-10-2-4-14(11(17)6-10)23-8-15(22)20-19-7-9-1-3-13(21)12(18)5-9/h1-7,21H,8H2,(H,20,22)/b19-7- |
| InChIKey | LUMUOOBOBWJNOC-GXHLCREISA-N |
| XLogP | 3.83 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.07 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|