C22H14Cl4N2O4 — CID 45054818
[3-[(E)-[[2-(2,4-dichlorophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 2,4-dichlorobenzoate (PubChem CID 45054818) has the molecular formula C22H14Cl4N2O4 and a molecular weight of 512.18 g/mol. Its IUPAC name is [3-[(E)-[[2-(2,4-dichlorophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 2,4-dichlorobenzoate.
| Compound Name | [3-[(E)-[[2-(2,4-dichlorophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 2,4-dichlorobenzoate |
|---|---|
| PubChem CID | 45054818 |
| Molecular Formula | C22H14Cl4N2O4 |
| Molecular Weight | 512.18 g/mol |
| Exact Mass | 509.97 |
| IUPAC Name | [3-[(E)-[[2-(2,4-dichlorophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 2,4-dichlorobenzoate |
| SMILES | O=C(COc1ccc(Cl)cc1Cl)N/N=C/c1cccc(OC(=O)c2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C22H14Cl4N2O4/c23-14-4-6-17(18(25)9-14)22(30)32-16-3-1-2-13(8-16)11-27-28-21(29)12-31-20-7-5-15(24)10-19(20)26/h1-11H,12H2,(H,28,29)/b27-11+ |
| InChIKey | FPSFTMVJDAPLNB-LUOAPIJWSA-N |
| XLogP | 6.05 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.18 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|