C24H18Cl2N2O4 — CID 3778082
[3-[[(4-prop-2-enoxybenzoyl)hydrazinylidene]methyl]phenyl] 2,4-dichlorobenzoate (PubChem CID 3778082) has the molecular formula C24H18Cl2N2O4 and a molecular weight of 469.32 g/mol. Its IUPAC name is [3-[[(4-prop-2-enoxybenzoyl)hydrazinylidene]methyl]phenyl] 2,4-dichlorobenzoate.
| Compound Name | [3-[[(4-prop-2-enoxybenzoyl)hydrazinylidene]methyl]phenyl] 2,4-dichlorobenzoate |
|---|---|
| PubChem CID | 3778082 |
| Molecular Formula | C24H18Cl2N2O4 |
| Molecular Weight | 469.32 g/mol |
| Exact Mass | 468.06 |
| IUPAC Name | [3-[[(4-prop-2-enoxybenzoyl)hydrazinylidene]methyl]phenyl] 2,4-dichlorobenzoate |
| SMILES | C=CCOc1ccc(C(=O)NN=Cc2cccc(OC(=O)c3ccc(Cl)cc3Cl)c2)cc1 |
| InChI | InChI=1S/C24H18Cl2N2O4/c1-2-12-31-19-9-6-17(7-10-19)23(29)28-27-15-16-4-3-5-20(13-16)32-24(30)21-11-8-18(25)14-22(21)26/h2-11,13-15H,1,12H2,(H,28,29) |
| InChIKey | RWNYBPZVTOCRPY-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.32 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|