C15H10BrCl2IN2O3 — CID 136909116
N-[(Z)-(5-bromo-2-hydroxy-3-iodophenyl)methylideneamino]-2-(2,4-dichlorophenoxy)acetamide (PubChem CID 136909116) has the molecular formula C15H10BrCl2IN2O3 and a molecular weight of 543.97 g/mol. Its IUPAC name is N-[(Z)-(5-bromo-2-hydroxy-3-iodophenyl)methylideneamino]-2-(2,4-dichlorophenoxy)acetamide.
| Compound Name | N-[(Z)-(5-bromo-2-hydroxy-3-iodophenyl)methylideneamino]-2-(2,4-dichlorophenoxy)acetamide |
|---|---|
| PubChem CID | 136909116 |
| Molecular Formula | C15H10BrCl2IN2O3 |
| Molecular Weight | 543.97 g/mol |
| Exact Mass | 541.83 |
| IUPAC Name | N-[(Z)-(5-bromo-2-hydroxy-3-iodophenyl)methylideneamino]-2-(2,4-dichlorophenoxy)acetamide |
| SMILES | O=C(COc1ccc(Cl)cc1Cl)N/N=C\c1cc(Br)cc(I)c1O |
| InChI | InChI=1S/C15H10BrCl2IN2O3/c16-9-3-8(15(23)12(19)4-9)6-20-21-14(22)7-24-13-2-1-10(17)5-11(13)18/h1-6,23H,7H2,(H,21,22)/b20-6- |
| InChIKey | BZIKPNBWTBRHCB-IOXNKQMXSA-N |
| XLogP | 4.60 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.97 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|