C17H21Cl2NO — CID 6042674
(E)-N-cyclooctyl-3-(2,4-dichlorophenyl)prop-2-enamide (PubChem CID 6042674) has the molecular formula C17H21Cl2NO and a molecular weight of 326.27 g/mol. Its IUPAC name is (E)-N-cyclooctyl-3-(2,4-dichlorophenyl)prop-2-enamide.
| Compound Name | (E)-N-cyclooctyl-3-(2,4-dichlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 6042674 |
| Molecular Formula | C17H21Cl2NO |
| Molecular Weight | 326.27 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | (E)-N-cyclooctyl-3-(2,4-dichlorophenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(Cl)cc1Cl)NC1CCCCCCC1 |
| InChI | InChI=1S/C17H21Cl2NO/c18-14-10-8-13(16(19)12-14)9-11-17(21)20-15-6-4-2-1-3-5-7-15/h8-12,15H,1-7H2,(H,20,21)/b11-9+ |
| InChIKey | GWPFFJPKESDPQC-PKNBQFBNSA-N |
| XLogP | 5.24 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.27 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|