C17H22Cl2N2O — CID 9264474
(E)-3-(2,4-dichlorophenyl)-N-(1-propylpiperidin-4-yl)prop-2-enamide (PubChem CID 9264474) has the molecular formula C17H22Cl2N2O and a molecular weight of 341.28 g/mol. Its IUPAC name is (E)-3-(2,4-dichlorophenyl)-N-(1-propylpiperidin-4-yl)prop-2-enamide.
| Compound Name | (E)-3-(2,4-dichlorophenyl)-N-(1-propylpiperidin-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 9264474 |
| Molecular Formula | C17H22Cl2N2O |
| Molecular Weight | 341.28 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | (E)-3-(2,4-dichlorophenyl)-N-(1-propylpiperidin-4-yl)prop-2-enamide |
| SMILES | CCCN1CCC(NC(=O)/C=C/c2ccc(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C17H22Cl2N2O/c1-2-9-21-10-7-15(8-11-21)20-17(22)6-4-13-3-5-14(18)12-16(13)19/h3-6,12,15H,2,7-11H2,1H3,(H,20,22)/b6-4+ |
| InChIKey | XTKYQICYGBNXQQ-GQCTYLIASA-N |
| XLogP | 4.00 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.28 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|