C19H23Cl2NO3 — CID 140528510
ethyl 1-[(E)-5-(2,4-dichlorophenyl)-3-oxopent-4-enyl]piperidine-4-carboxylate (PubChem CID 140528510) has the molecular formula C19H23Cl2NO3 and a molecular weight of 384.30 g/mol. Its IUPAC name is ethyl 1-[(E)-5-(2,4-dichlorophenyl)-3-oxopent-4-enyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[(E)-5-(2,4-dichlorophenyl)-3-oxopent-4-enyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 140528510 |
| Molecular Formula | C19H23Cl2NO3 |
| Molecular Weight | 384.30 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | ethyl 1-[(E)-5-(2,4-dichlorophenyl)-3-oxopent-4-enyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(CCC(=O)/C=C/c2ccc(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C19H23Cl2NO3/c1-2-25-19(24)15-7-10-22(11-8-15)12-9-17(23)6-4-14-3-5-16(20)13-18(14)21/h3-6,13,15H,2,7-12H2,1H3/b6-4+ |
| InChIKey | DFPIOGMYXRVJAD-GQCTYLIASA-N |
| XLogP | 4.24 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.30 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|