C29H32ClNO6S — CID 51355643
ethyl 1-[(E)-5-(4-chlorophenyl)-3-oxopent-4-enyl]piperidine-4-carboxylate;naphthalene-2-sulfonic acid (PubChem CID 51355643) has the molecular formula C29H32ClNO6S and a molecular weight of 558.10 g/mol. Its IUPAC name is ethyl 1-[(E)-5-(4-chlorophenyl)-3-oxopent-4-enyl]piperidine-4-carboxylate;naphthalene-2-sulfonic acid.
| Compound Name | ethyl 1-[(E)-5-(4-chlorophenyl)-3-oxopent-4-enyl]piperidine-4-carboxylate;naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 51355643 |
| Molecular Formula | C29H32ClNO6S |
| Molecular Weight | 558.10 g/mol |
| Exact Mass | 557.16 |
| IUPAC Name | ethyl 1-[(E)-5-(4-chlorophenyl)-3-oxopent-4-enyl]piperidine-4-carboxylate;naphthalene-2-sulfonic acid |
| SMILES | CCOC(=O)C1CCN(CCC(=O)/C=C/c2ccc(Cl)cc2)CC1.O=S(=O)(O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C19H24ClNO3.C10H8O3S/c1-2-24-19(23)16-9-12-21(13-10-16)14-11-18(22)8-5-15-3-6-17(20)7-4-15;11-14(12,13)10-6-5-8-3-1-2-4-9(8)7-10/h3-8,16H,2,9-14H2,1H3;1-7H,(H,11,12,13)/b8-5+; |
| InChIKey | YJCIOZBYRAPQBC-HAAWTFQLSA-N |
| XLogP | 5.67 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.10 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|