C19H26ClNO4 — CID 140528482
ethyl 1-[(E)-5-(4-hydroxyphenyl)-3-oxopent-4-enyl]piperidine-4-carboxylate;hydrochloride (PubChem CID 140528482) has the molecular formula C19H26ClNO4 and a molecular weight of 367.87 g/mol. Its IUPAC name is ethyl 1-[(E)-5-(4-hydroxyphenyl)-3-oxopent-4-enyl]piperidine-4-carboxylate;hydrochloride.
| Compound Name | ethyl 1-[(E)-5-(4-hydroxyphenyl)-3-oxopent-4-enyl]piperidine-4-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 140528482 |
| Molecular Formula | C19H26ClNO4 |
| Molecular Weight | 367.87 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | ethyl 1-[(E)-5-(4-hydroxyphenyl)-3-oxopent-4-enyl]piperidine-4-carboxylate;hydrochloride |
| SMILES | CCOC(=O)C1CCN(CCC(=O)/C=C/c2ccc(O)cc2)CC1.Cl |
| InChI | InChI=1S/C19H25NO4.ClH/c1-2-24-19(23)16-9-12-20(13-10-16)14-11-18(22)8-5-15-3-6-17(21)7-4-15;/h3-8,16,21H,2,9-14H2,1H3;1H/b8-5+; |
| InChIKey | TUVYRZZUUDWCSJ-HAAWTFQLSA-N |
| XLogP | 3.06 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.87 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|