C18H20F3NO3 — CID 102603299
ethyl 1-[3-[4-(trifluoromethyl)phenyl]prop-2-enoyl]piperidine-4-carboxylate (PubChem CID 102603299) has the molecular formula C18H20F3NO3 and a molecular weight of 355.36 g/mol. Its IUPAC name is ethyl 1-[3-[4-(trifluoromethyl)phenyl]prop-2-enoyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[3-[4-(trifluoromethyl)phenyl]prop-2-enoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 102603299 |
| Molecular Formula | C18H20F3NO3 |
| Molecular Weight | 355.36 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | ethyl 1-[3-[4-(trifluoromethyl)phenyl]prop-2-enoyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)C=Cc2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C18H20F3NO3/c1-2-25-17(24)14-9-11-22(12-10-14)16(23)8-5-13-3-6-15(7-4-13)18(19,20)21/h3-8,14H,2,9-12H2,1H3 |
| InChIKey | XDPUEGJDLQXSGU-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.36 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|