C15H15F3N2O3 — CID 130454938
4-[3-[4-(trifluoromethyl)phenyl]prop-2-enoyl]piperazine-1-carboxylic acid (PubChem CID 130454938) has the molecular formula C15H15F3N2O3 and a molecular weight of 328.29 g/mol. Its IUPAC name is 4-[3-[4-(trifluoromethyl)phenyl]prop-2-enoyl]piperazine-1-carboxylic acid.
| Compound Name | 4-[3-[4-(trifluoromethyl)phenyl]prop-2-enoyl]piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 130454938 |
| Molecular Formula | C15H15F3N2O3 |
| Molecular Weight | 328.29 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | 4-[3-[4-(trifluoromethyl)phenyl]prop-2-enoyl]piperazine-1-carboxylic acid |
| SMILES | O=C(O)N1CCN(C(=O)C=Cc2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C15H15F3N2O3/c16-15(17,18)12-4-1-11(2-5-12)3-6-13(21)19-7-9-20(10-8-19)14(22)23/h1-6H,7-10H2,(H,22,23) |
| InChIKey | JBOCGTFZVJXBJH-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.29 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|