C15H15F3N2O2 — CID 108567613
(E)-3-phenyl-1-[4-(2,2,2-trifluoroacetyl)piperazin-1-yl]prop-2-en-1-one (PubChem CID 108567613) has the molecular formula C15H15F3N2O2 and a molecular weight of 312.29 g/mol. Its IUPAC name is (E)-3-phenyl-1-[4-(2,2,2-trifluoroacetyl)piperazin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-phenyl-1-[4-(2,2,2-trifluoroacetyl)piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 108567613 |
| Molecular Formula | C15H15F3N2O2 |
| Molecular Weight | 312.29 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | (E)-3-phenyl-1-[4-(2,2,2-trifluoroacetyl)piperazin-1-yl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccccc1)N1CCN(C(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C15H15F3N2O2/c16-15(17,18)14(22)20-10-8-19(9-11-20)13(21)7-6-12-4-2-1-3-5-12/h1-7H,8-11H2/b7-6+ |
| InChIKey | QPYRFYWXJJDXBZ-VOTSOKGWSA-N |
| XLogP | 1.93 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.29 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|