C14H15F3N2O2 — CID 108533382
2,2,2-trifluoro-1-[4-(2-phenylacetyl)piperazin-1-yl]ethanone (PubChem CID 108533382) has the molecular formula C14H15F3N2O2 and a molecular weight of 300.28 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-[4-(2-phenylacetyl)piperazin-1-yl]ethanone.
| Compound Name | 2,2,2-trifluoro-1-[4-(2-phenylacetyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 108533382 |
| Molecular Formula | C14H15F3N2O2 |
| Molecular Weight | 300.28 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 2,2,2-trifluoro-1-[4-(2-phenylacetyl)piperazin-1-yl]ethanone |
| SMILES | O=C(Cc1ccccc1)N1CCN(C(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C14H15F3N2O2/c15-14(16,17)13(21)19-8-6-18(7-9-19)12(20)10-11-4-2-1-3-5-11/h1-5H,6-10H2 |
| InChIKey | FNSYNXLNAKYDSR-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.28 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |