C16H17F3N2O2 — CID 108563408
(E)-3-phenyl-N-[1-(2,2,2-trifluoroacetyl)piperidin-4-yl]prop-2-enamide (PubChem CID 108563408) has the molecular formula C16H17F3N2O2 and a molecular weight of 326.32 g/mol. Its IUPAC name is (E)-3-phenyl-N-[1-(2,2,2-trifluoroacetyl)piperidin-4-yl]prop-2-enamide.
| Compound Name | (E)-3-phenyl-N-[1-(2,2,2-trifluoroacetyl)piperidin-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 108563408 |
| Molecular Formula | C16H17F3N2O2 |
| Molecular Weight | 326.32 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | (E)-3-phenyl-N-[1-(2,2,2-trifluoroacetyl)piperidin-4-yl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1)NC1CCN(C(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C16H17F3N2O2/c17-16(18,19)15(23)21-10-8-13(9-11-21)20-14(22)7-6-12-4-2-1-3-5-12/h1-7,13H,8-11H2,(H,20,22)/b7-6+ |
| InChIKey | VLTZFCZXJSJKIN-VOTSOKGWSA-N |
| XLogP | 2.37 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.32 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|