C16H18F3N3O2 — CID 75534696
4-[[(E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoyl]amino]piperidine-1-carboxamide (PubChem CID 75534696) has the molecular formula C16H18F3N3O2 and a molecular weight of 341.33 g/mol. Its IUPAC name is 4-[[(E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoyl]amino]piperidine-1-carboxamide.
| Compound Name | 4-[[(E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoyl]amino]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 75534696 |
| Molecular Formula | C16H18F3N3O2 |
| Molecular Weight | 341.33 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 4-[[(E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoyl]amino]piperidine-1-carboxamide |
| SMILES | NC(=O)N1CCC(NC(=O)/C=C/c2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C16H18F3N3O2/c17-16(18,19)12-4-1-11(2-5-12)3-6-14(23)21-13-7-9-22(10-8-13)15(20)24/h1-6,13H,7-10H2,(H2,20,24)(H,21,23)/b6-3+ |
| InChIKey | GWGQZKVZDYWGJK-ZZXKWVIFSA-N |
| XLogP | 2.38 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.33 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|