C19H27NO — CID 1322783
(E)-3-(4-tert-butylphenyl)-N-cyclohexylprop-2-enamide (PubChem CID 1322783) has the molecular formula C19H27NO and a molecular weight of 285.43 g/mol. Its IUPAC name is (E)-3-(4-tert-butylphenyl)-N-cyclohexylprop-2-enamide.
| Compound Name | (E)-3-(4-tert-butylphenyl)-N-cyclohexylprop-2-enamide |
|---|---|
| PubChem CID | 1322783 |
| Molecular Formula | C19H27NO |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.21 |
| IUPAC Name | (E)-3-(4-tert-butylphenyl)-N-cyclohexylprop-2-enamide |
| SMILES | CC(C)(C)c1ccc(/C=C/C(=O)NC2CCCCC2)cc1 |
| InChI | InChI=1S/C19H27NO/c1-19(2,3)16-12-9-15(10-13-16)11-14-18(21)20-17-7-5-4-6-8-17/h9-14,17H,4-8H2,1-3H3,(H,20,21)/b14-11+ |
| InChIKey | FAXVVUOJXBNKTJ-SDNWHVSQSA-N |
| XLogP | 4.45 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|