C20H29NO — CID 6267818
(E)-N-cyclooctyl-3-(4-propan-2-ylphenyl)prop-2-enamide (PubChem CID 6267818) has the molecular formula C20H29NO and a molecular weight of 299.46 g/mol. Its IUPAC name is (E)-N-cyclooctyl-3-(4-propan-2-ylphenyl)prop-2-enamide.
| Compound Name | (E)-N-cyclooctyl-3-(4-propan-2-ylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 6267818 |
| Molecular Formula | C20H29NO |
| Molecular Weight | 299.46 g/mol |
| Exact Mass | 299.22 |
| IUPAC Name | (E)-N-cyclooctyl-3-(4-propan-2-ylphenyl)prop-2-enamide |
| SMILES | CC(C)c1ccc(/C=C/C(=O)NC2CCCCCCC2)cc1 |
| InChI | InChI=1S/C20H29NO/c1-16(2)18-13-10-17(11-14-18)12-15-20(22)21-19-8-6-4-3-5-7-9-19/h10-16,19H,3-9H2,1-2H3,(H,21,22)/b15-12+ |
| InChIKey | PDDXXBWIHDVKQX-NTCAYCPXSA-N |
| XLogP | 5.05 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.46 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|