C16H21NO — CID 6027758
(E)-N-cycloheptyl-3-phenylprop-2-enamide (PubChem CID 6027758) has the molecular formula C16H21NO and a molecular weight of 243.35 g/mol. Its IUPAC name is (E)-N-cycloheptyl-3-phenylprop-2-enamide.
| Compound Name | (E)-N-cycloheptyl-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 6027758 |
| Molecular Formula | C16H21NO |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.16 |
| IUPAC Name | (E)-N-cycloheptyl-3-phenylprop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1)NC1CCCCCC1 |
| InChI | InChI=1S/C16H21NO/c18-16(13-12-14-8-4-3-5-9-14)17-15-10-6-1-2-7-11-15/h3-5,8-9,12-13,15H,1-2,6-7,10-11H2,(H,17,18)/b13-12+ |
| InChIKey | AAXHJPGTJKYYNC-OUKQBFOZSA-N |
| XLogP | 3.54 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|