C20H26N2O2 — CID 35559791
4-[(E)-3-(cycloheptylamino)-3-oxoprop-1-enyl]-N-cyclopropylbenzamide (PubChem CID 35559791) has the molecular formula C20H26N2O2 and a molecular weight of 326.44 g/mol. Its IUPAC name is 4-[(E)-3-(cycloheptylamino)-3-oxoprop-1-enyl]-N-cyclopropylbenzamide.
| Compound Name | 4-[(E)-3-(cycloheptylamino)-3-oxoprop-1-enyl]-N-cyclopropylbenzamide |
|---|---|
| PubChem CID | 35559791 |
| Molecular Formula | C20H26N2O2 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.20 |
| IUPAC Name | 4-[(E)-3-(cycloheptylamino)-3-oxoprop-1-enyl]-N-cyclopropylbenzamide |
| SMILES | O=C(/C=C/c1ccc(C(=O)NC2CC2)cc1)NC1CCCCCC1 |
| InChI | InChI=1S/C20H26N2O2/c23-19(21-17-5-3-1-2-4-6-17)14-9-15-7-10-16(11-8-15)20(24)22-18-12-13-18/h7-11,14,17-18H,1-6,12-13H2,(H,21,23)(H,22,24)/b14-9+ |
| InChIKey | WLEHYYAWLKZJQS-NTEUORMPSA-N |
| XLogP | 3.43 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|