C19H27NO — CID 59811420
N-cyclohexyl-4-[(E)-3,3-dimethylbut-1-enyl]benzamide (PubChem CID 59811420) has the molecular formula C19H27NO and a molecular weight of 285.43 g/mol. Its IUPAC name is N-cyclohexyl-4-[(E)-3,3-dimethylbut-1-enyl]benzamide.
| Compound Name | N-cyclohexyl-4-[(E)-3,3-dimethylbut-1-enyl]benzamide |
|---|---|
| PubChem CID | 59811420 |
| Molecular Formula | C19H27NO |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.21 |
| IUPAC Name | N-cyclohexyl-4-[(E)-3,3-dimethylbut-1-enyl]benzamide |
| SMILES | CC(C)(C)/C=C/c1ccc(C(=O)NC2CCCCC2)cc1 |
| InChI | InChI=1S/C19H27NO/c1-19(2,3)14-13-15-9-11-16(12-10-15)18(21)20-17-7-5-4-6-8-17/h9-14,17H,4-8H2,1-3H3,(H,20,21)/b14-13+ |
| InChIKey | YBCQFZBHZJJQIQ-BUHFOSPRSA-N |
| XLogP | 4.81 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |