C18H24N2O2 — CID 109043526
4-N-cycloheptyl-1-N-prop-2-enylbenzene-1,4-dicarboxamide (PubChem CID 109043526) has the molecular formula C18H24N2O2 and a molecular weight of 300.40 g/mol. Its IUPAC name is 4-N-cycloheptyl-1-N-prop-2-enylbenzene-1,4-dicarboxamide.
| Compound Name | 4-N-cycloheptyl-1-N-prop-2-enylbenzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 109043526 |
| Molecular Formula | C18H24N2O2 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | 4-N-cycloheptyl-1-N-prop-2-enylbenzene-1,4-dicarboxamide |
| SMILES | C=CCNC(=O)c1ccc(C(=O)NC2CCCCCC2)cc1 |
| InChI | InChI=1S/C18H24N2O2/c1-2-13-19-17(21)14-9-11-15(12-10-14)18(22)20-16-7-5-3-4-6-8-16/h2,9-12,16H,1,3-8,13H2,(H,19,21)(H,20,22) |
| InChIKey | HPXBCPCJSACTMI-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|